C21H24ClFN2O3S — CID 167147991
methyl 3-[[4-chloro-2,6-di(propan-2-yl)phenyl]carbamoylamino]sulfanyl-4-fluorobenzoate (PubChem CID 167147991) has the molecular formula C21H24ClFN2O3S and a molecular weight of 438.95 g/mol. Its IUPAC name is methyl 3-[[4-chloro-2,6-di(propan-2-yl)phenyl]carbamoylamino]sulfanyl-4-fluorobenzoate.
| Compound Name | methyl 3-[[4-chloro-2,6-di(propan-2-yl)phenyl]carbamoylamino]sulfanyl-4-fluorobenzoate |
|---|---|
| PubChem CID | 167147991 |
| Molecular Formula | C21H24ClFN2O3S |
| Molecular Weight | 438.95 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | methyl 3-[[4-chloro-2,6-di(propan-2-yl)phenyl]carbamoylamino]sulfanyl-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)c(SNC(=O)Nc2c(C(C)C)cc(Cl)cc2C(C)C)c1 |
| InChI | InChI=1S/C21H24ClFN2O3S/c1-11(2)15-9-14(22)10-16(12(3)4)19(15)24-21(27)25-29-18-8-13(20(26)28-5)6-7-17(18)23/h6-12H,1-5H3,(H2,24,25,27) |
| InChIKey | FOBJBWCLYBZJMN-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.95 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|