C15H25NO2S2 — CID 167148661
1-[(3S,4S)-4-thiophen-2-ylsulfonylhexan-3-yl]piperidine (PubChem CID 167148661) has the molecular formula C15H25NO2S2 and a molecular weight of 315.50 g/mol. Its IUPAC name is 1-[(3S,4S)-4-thiophen-2-ylsulfonylhexan-3-yl]piperidine.
| Compound Name | 1-[(3S,4S)-4-thiophen-2-ylsulfonylhexan-3-yl]piperidine |
|---|---|
| PubChem CID | 167148661 |
| Molecular Formula | C15H25NO2S2 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-[(3S,4S)-4-thiophen-2-ylsulfonylhexan-3-yl]piperidine |
| SMILES | CC[C@@H]([C@H](CC)S(=O)(=O)c1cccs1)N1CCCCC1 |
| InChI | InChI=1S/C15H25NO2S2/c1-3-13(16-10-6-5-7-11-16)14(4-2)20(17,18)15-9-8-12-19-15/h8-9,12-14H,3-7,10-11H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | YNCMJIDOHIVDRX-KBPBESRZSA-N |
| XLogP | 3.56 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |