C10H17NO2S2 — CID 117037755
N,3-dimethyl-2-thiophen-2-ylsulfonylbutan-1-amine (PubChem CID 117037755) has the molecular formula C10H17NO2S2 and a molecular weight of 247.38 g/mol. Its IUPAC name is N,3-dimethyl-2-thiophen-2-ylsulfonylbutan-1-amine.
| Compound Name | N,3-dimethyl-2-thiophen-2-ylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 117037755 |
| Molecular Formula | C10H17NO2S2 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | N,3-dimethyl-2-thiophen-2-ylsulfonylbutan-1-amine |
| SMILES | CNCC(C(C)C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C10H17NO2S2/c1-8(2)9(7-11-3)15(12,13)10-5-4-6-14-10/h4-6,8-9,11H,7H2,1-3H3 |
| InChIKey | NEGVLPIKFCPUKI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |