C18H14ClF3N4O — CID 167150769
N-(2-chlorophenyl)-N-[3-(1,5-dimethylimidazol-4-yl)-6-(trifluoromethyl)-2-pyridinyl]formamide (PubChem CID 167150769) has the molecular formula C18H14ClF3N4O and a molecular weight of 394.78 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N-[3-(1,5-dimethylimidazol-4-yl)-6-(trifluoromethyl)-2-pyridinyl]formamide.
| Compound Name | N-(2-chlorophenyl)-N-[3-(1,5-dimethylimidazol-4-yl)-6-(trifluoromethyl)-2-pyridinyl]formamide |
|---|---|
| PubChem CID | 167150769 |
| Molecular Formula | C18H14ClF3N4O |
| Molecular Weight | 394.78 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | N-(2-chlorophenyl)-N-[3-(1,5-dimethylimidazol-4-yl)-6-(trifluoromethyl)-2-pyridinyl]formamide |
| SMILES | Cc1c(-c2ccc(C(F)(F)F)nc2N(C=O)c2ccccc2Cl)ncn1C |
| InChI | InChI=1S/C18H14ClF3N4O/c1-11-16(23-9-25(11)2)12-7-8-15(18(20,21)22)24-17(12)26(10-27)14-6-4-3-5-13(14)19/h3-10H,1-2H3 |
| InChIKey | PKCBTZZWNOMEMK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.78 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|