C14H20S — CID 167152155
1-(2,3,4,5-tetramethylphenyl)butane-1-thione (PubChem CID 167152155) has the molecular formula C14H20S and a molecular weight of 220.38 g/mol. Its IUPAC name is 1-(2,3,4,5-tetramethylphenyl)butane-1-thione.
| Compound Name | 1-(2,3,4,5-tetramethylphenyl)butane-1-thione |
|---|---|
| PubChem CID | 167152155 |
| Molecular Formula | C14H20S |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 1-(2,3,4,5-tetramethylphenyl)butane-1-thione |
| SMILES | CCCC(=S)c1cc(C)c(C)c(C)c1C |
| InChI | InChI=1S/C14H20S/c1-6-7-14(15)13-8-9(2)10(3)11(4)12(13)5/h8H,6-7H2,1-5H3 |
| InChIKey | UJWDXGRSHGZNCD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|