C15H20Cl2O2 — CID 167155735
(2S)-3-[3-(1,5-dichloropentan-3-yl)phenyl]-2-methylpropanoic acid (PubChem CID 167155735) has the molecular formula C15H20Cl2O2 and a molecular weight of 303.23 g/mol. Its IUPAC name is (2S)-3-[3-(1,5-dichloropentan-3-yl)phenyl]-2-methylpropanoic acid.
| Compound Name | (2S)-3-[3-(1,5-dichloropentan-3-yl)phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 167155735 |
| Molecular Formula | C15H20Cl2O2 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | (2S)-3-[3-(1,5-dichloropentan-3-yl)phenyl]-2-methylpropanoic acid |
| SMILES | C[C@@H](Cc1cccc(C(CCCl)CCCl)c1)C(=O)O |
| InChI | InChI=1S/C15H20Cl2O2/c1-11(15(18)19)9-12-3-2-4-14(10-12)13(5-7-16)6-8-17/h2-4,10-11,13H,5-9H2,1H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | OOMDHDLQNUWTBE-NSHDSACASA-N |
| XLogP | 4.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|