C19H26Cl2N4O3 — CID 167157424
(2R)-2-[(8R,9aS)-8-amino-5-methyl-1-oxo-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-2-yl]-N-[(3,4-dichlorophenyl)methyl]-3-hydroxypropanamide (PubChem CID 167157424) has the molecular formula C19H26Cl2N4O3 and a molecular weight of 429.35 g/mol. Its IUPAC name is (2R)-2-[(8R,9aS)-8-amino-5-methyl-1-oxo-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-2-yl]-N-[(3,4-dichlorophenyl)methyl]-3-hydroxypropanamide.
| Compound Name | (2R)-2-[(8R,9aS)-8-amino-5-methyl-1-oxo-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-2-yl]-N-[(3,4-dichlorophenyl)methyl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 167157424 |
| Molecular Formula | C19H26Cl2N4O3 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | (2R)-2-[(8R,9aS)-8-amino-5-methyl-1-oxo-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-2-yl]-N-[(3,4-dichlorophenyl)methyl]-3-hydroxypropanamide |
| SMILES | CC1CCN(C(CO)C(=O)NCc2ccc(Cl)c(Cl)c2)C(=O)[C@@H]2C[C@@H](N)CN12 |
| InChI | InChI=1S/C19H26Cl2N4O3/c1-11-4-5-24(19(28)16-7-13(22)9-25(11)16)17(10-26)18(27)23-8-12-2-3-14(20)15(21)6-12/h2-3,6,11,13,16-17,26H,4-5,7-10,22H2,1H3,(H,23,27)/t11?,13-,16+,17?/m1/s1 |
| InChIKey | YAHUVZWUYYPXGI-VWWFXPOASA-N |
| XLogP | 0.99 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |