C29H37Cl2N3O2 — CID 159405650
(8R,9aS)-2-[(3R)-1-amino-6-(3,4-dichlorophenyl)-4-oxohexan-3-yl]-8-methyl-5-(2-phenylethyl)-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-1-one (PubChem CID 159405650) has the molecular formula C29H37Cl2N3O2 and a molecular weight of 530.54 g/mol. Its IUPAC name is (8R,9aS)-2-[(3R)-1-amino-6-(3,4-dichlorophenyl)-4-oxohexan-3-yl]-8-methyl-5-(2-phenylethyl)-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-1-one.
| Compound Name | (8R,9aS)-2-[(3R)-1-amino-6-(3,4-dichlorophenyl)-4-oxohexan-3-yl]-8-methyl-5-(2-phenylethyl)-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-1-one |
|---|---|
| PubChem CID | 159405650 |
| Molecular Formula | C29H37Cl2N3O2 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | (8R,9aS)-2-[(3R)-1-amino-6-(3,4-dichlorophenyl)-4-oxohexan-3-yl]-8-methyl-5-(2-phenylethyl)-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-1-one |
| SMILES | C[C@@H]1C[C@H]2C(=O)N(C(CCN)C(=O)CCc3ccc(Cl)c(Cl)c3)CCC(CCc3ccccc3)N2C1 |
| InChI | InChI=1S/C29H37Cl2N3O2/c1-20-17-27-29(36)33(16-14-23(34(27)19-20)10-7-21-5-3-2-4-6-21)26(13-15-32)28(35)12-9-22-8-11-24(30)25(31)18-22/h2-6,8,11,18,20,23,26-27H,7,9-10,12-17,19,32H2,1H3/t20-,23?,26?,27+/m1/s1 |
| InChIKey | QPGYJLIKQBACOC-RSGLTDDDSA-N |
| XLogP | 5.16 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |