About 4-methyl-1,4λ5-azaphosphepane 4-oxide
4-methyl-1,4λ5-azaphosphepane 4-oxide (PubChem CID 167166277) has the molecular formula C6H14NOP
and a molecular weight of 147.16 g/mol. Its IUPAC name is 4-methyl-1,4λ5-azaphosphepane 4-oxide.
Molecular Properties
| Compound Name | 4-methyl-1,4λ5-azaphosphepane 4-oxide |
| PubChem CID | 167166277 |
| Molecular Formula | C6H14NOP |
| Molecular Weight | 147.16 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 4-methyl-1,4λ5-azaphosphepane 4-oxide |
| SMILES | CP1(=O)CCCNCC1 |
| InChI | InChI=1S/C6H14NOP/c1-9(8)5-2-3-7-4-6-9/h7H,2-6H2,1H3 |
| InChIKey | WABDFELVURHYQP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.16 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1,4λ5-azaphosphepane 4-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,4λ5-azaphosphepane 4-oxide?
The IUPAC name of 4-methyl-1,4λ5-azaphosphepane 4-oxide (CID 167166277) is 4-methyl-1,4λ5-azaphosphepane 4-oxide.
What is the SMILES notation for 4-methyl-1,4λ5-azaphosphepane 4-oxide?
The canonical SMILES for 4-methyl-1,4λ5-azaphosphepane 4-oxide is CP1(=O)CCCNCC1.
What is the InChIKey of 4-methyl-1,4λ5-azaphosphepane 4-oxide?
The InChIKey is WABDFELVURHYQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14NOP/c1-9(8)5-2-3-7-4-6-9/h7H,2-6H2,1H3.
What are the key properties of 4-methyl-1,4λ5-azaphosphepane 4-oxide?
4-methyl-1,4λ5-azaphosphepane 4-oxide has a molecular weight of 147.16 g/mol, XLogP of 0.97, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,4λ5-azaphosphepane 4-oxide is sourced from PubChem (CID 167166277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).