C6H15ClNOP — CID 67316802
4-ethyl-1,4λ5-azaphosphinane 4-oxide;hydrochloride (PubChem CID 67316802) has the molecular formula C6H15ClNOP and a molecular weight of 183.62 g/mol. Its IUPAC name is 4-ethyl-1,4λ5-azaphosphinane 4-oxide;hydrochloride.
| Compound Name | 4-ethyl-1,4λ5-azaphosphinane 4-oxide;hydrochloride |
|---|---|
| PubChem CID | 67316802 |
| Molecular Formula | C6H15ClNOP |
| Molecular Weight | 183.62 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 4-ethyl-1,4λ5-azaphosphinane 4-oxide;hydrochloride |
| SMILES | CCP1(=O)CCNCC1.Cl |
| InChI | InChI=1S/C6H14NOP.ClH/c1-2-9(8)5-3-7-4-6-9;/h7H,2-6H2,1H3;1H |
| InChIKey | HPNSBWCVEKQYFC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.62 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|