C32H32O — CID 167166746
3-tert-butyl-7-[2-methyl-2-(3-phenylphenyl)propyl]dibenzofuran (PubChem CID 167166746) has the molecular formula C32H32O and a molecular weight of 432.61 g/mol. Its IUPAC name is 3-tert-butyl-7-[2-methyl-2-(3-phenylphenyl)propyl]dibenzofuran.
| Compound Name | 3-tert-butyl-7-[2-methyl-2-(3-phenylphenyl)propyl]dibenzofuran |
|---|---|
| PubChem CID | 167166746 |
| Molecular Formula | C32H32O |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 3-tert-butyl-7-[2-methyl-2-(3-phenylphenyl)propyl]dibenzofuran |
| SMILES | CC(C)(C)c1ccc2c(c1)oc1cc(CC(C)(C)c3cccc(-c4ccccc4)c3)ccc12 |
| InChI | InChI=1S/C32H32O/c1-31(2,3)25-15-17-28-27-16-14-22(18-29(27)33-30(28)20-25)21-32(4,5)26-13-9-12-24(19-26)23-10-7-6-8-11-23/h6-20H,21H2,1-5H3 |
| InChIKey | DLMUYXGBEBUFLE-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |