C30H23F3N2O4 — CID 167167600
ethyl 3-[2-[6-[3-(dimethylcarbamoyl)-4-hydroxynaphthalen-1-yl]-3-pyridinyl]ethynyl]-5-(trifluoromethyl)benzoate (PubChem CID 167167600) has the molecular formula C30H23F3N2O4 and a molecular weight of 532.52 g/mol. Its IUPAC name is ethyl 3-[2-[6-[3-(dimethylcarbamoyl)-4-hydroxynaphthalen-1-yl]-3-pyridinyl]ethynyl]-5-(trifluoromethyl)benzoate.
| Compound Name | ethyl 3-[2-[6-[3-(dimethylcarbamoyl)-4-hydroxynaphthalen-1-yl]-3-pyridinyl]ethynyl]-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 167167600 |
| Molecular Formula | C30H23F3N2O4 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | ethyl 3-[2-[6-[3-(dimethylcarbamoyl)-4-hydroxynaphthalen-1-yl]-3-pyridinyl]ethynyl]-5-(trifluoromethyl)benzoate |
| SMILES | CCOC(=O)c1cc(C#Cc2ccc(-c3cc(C(=O)N(C)C)c(O)c4ccccc34)nc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H23F3N2O4/c1-4-39-29(38)20-13-19(14-21(15-20)30(31,32)33)10-9-18-11-12-26(34-17-18)24-16-25(28(37)35(2)3)27(36)23-8-6-5-7-22(23)24/h5-8,11-17,36H,4H2,1-3H3 |
| InChIKey | LQJBGRYDWAJXDN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|