About dipentadecan-8-yl 5-[2-(1-ethylpiperidin-4-yl)sulfanyl-2-oxoethyl]nonanedioate
dipentadecan-8-yl 5-[2-(1-ethylpiperidin-4-yl)sulfanyl-2-oxoethyl]nonanedioate (PubChem CID 167167924) has the molecular formula C48H91NO5S
and a molecular weight of 794.32 g/mol. Its IUPAC name is dipentadecan-8-yl 5-[2-(1-ethylpiperidin-4-yl)sulfanyl-2-oxoethyl]nonanedioate.
Molecular Properties
| Compound Name | dipentadecan-8-yl 5-[2-(1-ethylpiperidin-4-yl)sulfanyl-2-oxoethyl]nonanedioate |
| PubChem CID | 167167924 |
| Molecular Formula | C48H91NO5S |
| Molecular Weight | 794.32 g/mol |
| Exact Mass | 793.66 |
| IUPAC Name | dipentadecan-8-yl 5-[2-(1-ethylpiperidin-4-yl)sulfanyl-2-oxoethyl]nonanedioate |
| SMILES | CCCCCCCC(CCCCCCC)OC(=O)CCCC(CCCC(=O)OC(CCCCCCC)CCCCCCC)CC(=O)SC1CCN(CC)CC1 |
| InChI | InChI=1S/C48H91NO5S/c1-6-11-15-19-23-31-43(32-24-20-16-12-7-2)53-46(50)35-27-29-42(41-48(52)55-45-37-39-49(10-5)40-38-45)30-28-36-47(51)54-44(33-25-21-17-13-8-3)34-26-22-18-14-9-4/h42-45H,6-41H2,1-5H3 |
| InChIKey | CSTRZCQQEBJQPR-UHFFFAOYSA-N |
| XLogP | 14.34 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 794.32 |
| LogP ≤ 5 | 14.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze dipentadecan-8-yl 5-[2-(1-ethylpiperidin-4-yl)sulfanyl-2-oxoethyl]nonanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipentadecan-8-yl 5-[2-(1-ethylpiperidin-4-yl)sulfanyl-2-oxoethyl]nonanedioate?
The IUPAC name of dipentadecan-8-yl 5-[2-(1-ethylpiperidin-4-yl)sulfanyl-2-oxoethyl]nonanedioate (CID 167167924) is dipentadecan-8-yl 5-[2-(1-ethylpiperidin-4-yl)sulfanyl-2-oxoethyl]nonanedioate.
What is the SMILES notation for dipentadecan-8-yl 5-[2-(1-ethylpiperidin-4-yl)sulfanyl-2-oxoethyl]nonanedioate?
The canonical SMILES for dipentadecan-8-yl 5-[2-(1-ethylpiperidin-4-yl)sulfanyl-2-oxoethyl]nonanedioate is CCCCCCCC(CCCCCCC)OC(=O)CCCC(CCCC(=O)OC(CCCCCCC)CCCCCCC)CC(=O)SC1CCN(CC)CC1.
What is the InChIKey of dipentadecan-8-yl 5-[2-(1-ethylpiperidin-4-yl)sulfanyl-2-oxoethyl]nonanedioate?
The InChIKey is CSTRZCQQEBJQPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C48H91NO5S/c1-6-11-15-19-23-31-43(32-24-20-16-12-7-2)53-46(50)35-27-29-42(41-48(52)55-45-37-39-49(10-5)40-38-45)30-28-36-47(51)54-44(33-25-21-17-13-8-3)34-26-22-18-14-9-4/h42-45H,6-41H2,1-5H3.
What are the key properties of dipentadecan-8-yl 5-[2-(1-ethylpiperidin-4-yl)sulfanyl-2-oxoethyl]nonanedioate?
dipentadecan-8-yl 5-[2-(1-ethylpiperidin-4-yl)sulfanyl-2-oxoethyl]nonanedioate has a molecular weight of 794.32 g/mol, XLogP of 14.34, 38 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dipentadecan-8-yl 5-[2-(1-ethylpiperidin-4-yl)sulfanyl-2-oxoethyl]nonanedioate is sourced from PubChem (CID 167167924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).