C26H40O — CID 167169577
10,13-dimethyl-17-[(2E)-5-methylhexa-2,4-dienyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 167169577) has the molecular formula C26H40O and a molecular weight of 368.61 g/mol. Its IUPAC name is 10,13-dimethyl-17-[(2E)-5-methylhexa-2,4-dienyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | 10,13-dimethyl-17-[(2E)-5-methylhexa-2,4-dienyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 167169577 |
| Molecular Formula | C26H40O |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.31 |
| IUPAC Name | 10,13-dimethyl-17-[(2E)-5-methylhexa-2,4-dienyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)=C/C=C/CC1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C26H40O/c1-18(2)7-5-6-8-19-10-12-23-22-11-9-20-17-21(27)13-15-26(20,4)24(22)14-16-25(19,23)3/h5-7,9,19,21-24,27H,8,10-17H2,1-4H3/b6-5+ |
| InChIKey | ZWHXYPTVSYLIKG-AATRIKPKSA-N |
| XLogP | 6.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|