C12H13F3N2 — CID 167170311
N-[(Z)-[4-prop-1-en-2-yl-1-(2,2,2-trifluoroethyl)-2-pyridinylidene]methyl]methanimine (PubChem CID 167170311) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is N-[(Z)-[4-prop-1-en-2-yl-1-(2,2,2-trifluoroethyl)-2-pyridinylidene]methyl]methanimine.
| Compound Name | N-[(Z)-[4-prop-1-en-2-yl-1-(2,2,2-trifluoroethyl)-2-pyridinylidene]methyl]methanimine |
|---|---|
| PubChem CID | 167170311 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | N-[(Z)-[4-prop-1-en-2-yl-1-(2,2,2-trifluoroethyl)-2-pyridinylidene]methyl]methanimine |
| SMILES | C=N/C=C1/C=C(C(=C)C)C=CN1CC(F)(F)F |
| InChI | InChI=1S/C12H13F3N2/c1-9(2)10-4-5-17(8-12(13,14)15)11(6-10)7-16-3/h4-7H,1,3,8H2,2H3/b11-7- |
| InChIKey | HZZGMWRJPBTQMR-XFFZJAGNSA-N |
| XLogP | 3.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|