C16H19ClN4O2 — CID 167170749
4-(4-methyl-2-oxopiperazin-1-yl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carbonyl chloride (PubChem CID 167170749) has the molecular formula C16H19ClN4O2 and a molecular weight of 334.81 g/mol. Its IUPAC name is 4-(4-methyl-2-oxopiperazin-1-yl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carbonyl chloride.
| Compound Name | 4-(4-methyl-2-oxopiperazin-1-yl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carbonyl chloride |
|---|---|
| PubChem CID | 167170749 |
| Molecular Formula | C16H19ClN4O2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 4-(4-methyl-2-oxopiperazin-1-yl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carbonyl chloride |
| SMILES | Cc1ccc(C2=NN(C(=O)Cl)CC2N2CCN(C)CC2=O)cc1 |
| InChI | InChI=1S/C16H19ClN4O2/c1-11-3-5-12(6-4-11)15-13(9-21(18-15)16(17)23)20-8-7-19(2)10-14(20)22/h3-6,13H,7-10H2,1-2H3 |
| InChIKey | NDHJAFOHWFGJPQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|