C15H16ClN3O4 — CID 167170830
5-(4-methoxyphenyl)-4-(3-oxomorpholin-4-yl)-3,4-dihydropyrazole-2-carbonyl chloride (PubChem CID 167170830) has the molecular formula C15H16ClN3O4 and a molecular weight of 337.76 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-4-(3-oxomorpholin-4-yl)-3,4-dihydropyrazole-2-carbonyl chloride.
| Compound Name | 5-(4-methoxyphenyl)-4-(3-oxomorpholin-4-yl)-3,4-dihydropyrazole-2-carbonyl chloride |
|---|---|
| PubChem CID | 167170830 |
| Molecular Formula | C15H16ClN3O4 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 5-(4-methoxyphenyl)-4-(3-oxomorpholin-4-yl)-3,4-dihydropyrazole-2-carbonyl chloride |
| SMILES | COc1ccc(C2=NN(C(=O)Cl)CC2N2CCOCC2=O)cc1 |
| InChI | InChI=1S/C15H16ClN3O4/c1-22-11-4-2-10(3-5-11)14-12(8-19(17-14)15(16)21)18-6-7-23-9-13(18)20/h2-5,12H,6-9H2,1H3 |
| InChIKey | ANYQXBOURYDRNI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|