C28H26F3N7O2S — CID 167171123
N-[2-[(8R,8aR)-8-amino-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-4-phenoxy-3-(trifluoromethyl)phenyl]-2-pyridazin-4-yl-1,3-thiazole-4-carboxamide (PubChem CID 167171123) has the molecular formula C28H26F3N7O2S and a molecular weight of 581.62 g/mol. Its IUPAC name is N-[2-[(8R,8aR)-8-amino-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-4-phenoxy-3-(trifluoromethyl)phenyl]-2-pyridazin-4-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-[(8R,8aR)-8-amino-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-4-phenoxy-3-(trifluoromethyl)phenyl]-2-pyridazin-4-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 167171123 |
| Molecular Formula | C28H26F3N7O2S |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | N-[2-[(8R,8aR)-8-amino-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-4-phenoxy-3-(trifluoromethyl)phenyl]-2-pyridazin-4-yl-1,3-thiazole-4-carboxamide |
| SMILES | N[C@@H]1CCN2CCN(c3c(NC(=O)c4csc(-c5ccnnc5)n4)ccc(Oc4ccccc4)c3C(F)(F)F)C[C@H]12 |
| InChI | InChI=1S/C28H26F3N7O2S/c29-28(30,31)24-23(40-18-4-2-1-3-5-18)7-6-20(25(24)38-13-12-37-11-9-19(32)22(37)15-38)35-26(39)21-16-41-27(36-21)17-8-10-33-34-14-17/h1-8,10,14,16,19,22H,9,11-13,15,32H2,(H,35,39)/t19-,22-/m1/s1 |
| InChIKey | JLCJTIWNGRUUSI-DENIHFKCSA-N |
| XLogP | 4.89 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |