C31H34FN5O2S — CID 167574872
N-[4-(3-fluorophenoxy)-3-methyl-2-[(3R)-3-pentylpiperidin-1-yl]phenyl]-2-pyridazin-4-yl-1,3-thiazole-4-carboxamide (PubChem CID 167574872) has the molecular formula C31H34FN5O2S and a molecular weight of 559.71 g/mol. Its IUPAC name is N-[4-(3-fluorophenoxy)-3-methyl-2-[(3R)-3-pentylpiperidin-1-yl]phenyl]-2-pyridazin-4-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-(3-fluorophenoxy)-3-methyl-2-[(3R)-3-pentylpiperidin-1-yl]phenyl]-2-pyridazin-4-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 167574872 |
| Molecular Formula | C31H34FN5O2S |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | N-[4-(3-fluorophenoxy)-3-methyl-2-[(3R)-3-pentylpiperidin-1-yl]phenyl]-2-pyridazin-4-yl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCC[C@@H]1CCCN(c2c(NC(=O)c3csc(-c4ccnnc4)n3)ccc(Oc3cccc(F)c3)c2C)C1 |
| InChI | InChI=1S/C31H34FN5O2S/c1-3-4-5-8-22-9-7-16-37(19-22)29-21(2)28(39-25-11-6-10-24(32)17-25)13-12-26(29)35-30(38)27-20-40-31(36-27)23-14-15-33-34-18-23/h6,10-15,17-18,20,22H,3-5,7-9,16,19H2,1-2H3,(H,35,38)/t22-/m1/s1 |
| InChIKey | GJVOVVURLRUZPH-JOCHJYFZSA-N |
| XLogP | 7.89 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|