C27H21F6NO3S — CID 167174388
5-[[2,4-bis(trifluoromethyl)phenyl]methyl-(2-phenylethyl)amino]sulfanyl-3-methyl-1-benzofuran-2-carboxylic acid (PubChem CID 167174388) has the molecular formula C27H21F6NO3S and a molecular weight of 553.52 g/mol. Its IUPAC name is 5-[[2,4-bis(trifluoromethyl)phenyl]methyl-(2-phenylethyl)amino]sulfanyl-3-methyl-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-[[2,4-bis(trifluoromethyl)phenyl]methyl-(2-phenylethyl)amino]sulfanyl-3-methyl-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 167174388 |
| Molecular Formula | C27H21F6NO3S |
| Molecular Weight | 553.52 g/mol |
| Exact Mass | 553.11 |
| IUPAC Name | 5-[[2,4-bis(trifluoromethyl)phenyl]methyl-(2-phenylethyl)amino]sulfanyl-3-methyl-1-benzofuran-2-carboxylic acid |
| SMILES | Cc1c(C(=O)O)oc2ccc(SN(CCc3ccccc3)Cc3ccc(C(F)(F)F)cc3C(F)(F)F)cc12 |
| InChI | InChI=1S/C27H21F6NO3S/c1-16-21-14-20(9-10-23(21)37-24(16)25(35)36)38-34(12-11-17-5-3-2-4-6-17)15-18-7-8-19(26(28,29)30)13-22(18)27(31,32)33/h2-10,13-14H,11-12,15H2,1H3,(H,35,36) |
| InChIKey | FOGZFPXEOLZPSF-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.52 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|