C27H26FNO3S — CID 167174307
ethyl 5-[(2-fluorophenyl)methyl-(2-phenylethyl)amino]sulfanyl-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 167174307) has the molecular formula C27H26FNO3S and a molecular weight of 463.57 g/mol. Its IUPAC name is ethyl 5-[(2-fluorophenyl)methyl-(2-phenylethyl)amino]sulfanyl-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-[(2-fluorophenyl)methyl-(2-phenylethyl)amino]sulfanyl-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 167174307 |
| Molecular Formula | C27H26FNO3S |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | ethyl 5-[(2-fluorophenyl)methyl-(2-phenylethyl)amino]sulfanyl-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccc(SN(CCc3ccccc3)Cc3ccccc3F)cc2c1C |
| InChI | InChI=1S/C27H26FNO3S/c1-3-31-27(30)26-19(2)23-17-22(13-14-25(23)32-26)33-29(16-15-20-9-5-4-6-10-20)18-21-11-7-8-12-24(21)28/h4-14,17H,3,15-16,18H2,1-2H3 |
| InChIKey | DIYSJRSSJPSABH-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|