C31H35N3O3S2 — CID 167174654
ethyl 3-methyl-5-[2-(4-methylsulfanylpiperazin-1-yl)-N-(2-phenylethyl)anilino]sulfanyl-1-benzofuran-2-carboxylate (PubChem CID 167174654) has the molecular formula C31H35N3O3S2 and a molecular weight of 561.77 g/mol. Its IUPAC name is ethyl 3-methyl-5-[2-(4-methylsulfanylpiperazin-1-yl)-N-(2-phenylethyl)anilino]sulfanyl-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-methyl-5-[2-(4-methylsulfanylpiperazin-1-yl)-N-(2-phenylethyl)anilino]sulfanyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 167174654 |
| Molecular Formula | C31H35N3O3S2 |
| Molecular Weight | 561.77 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | ethyl 3-methyl-5-[2-(4-methylsulfanylpiperazin-1-yl)-N-(2-phenylethyl)anilino]sulfanyl-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccc(SN(CCc3ccccc3)c3ccccc3N3CCN(SC)CC3)cc2c1C |
| InChI | InChI=1S/C31H35N3O3S2/c1-4-36-31(35)30-23(2)26-22-25(14-15-29(26)37-30)39-34(17-16-24-10-6-5-7-11-24)28-13-9-8-12-27(28)32-18-20-33(38-3)21-19-32/h5-15,22H,4,16-21H2,1-3H3 |
| InChIKey | BLDTXCKQFDCDNB-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 49.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.77 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|