C28H31N3O9 — CID 167175071
[2-[6-(1-hydroxy-2-oxoethyl)-7-(methoxymethyl)-8-oxo-16,18-dioxa-2,9-diazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1(20),2,4,6,11,13,15(19)-heptaen-12-yl]ethyl-propan-2-ylamino]oxymethyl acetate (PubChem CID 167175071) has the molecular formula C28H31N3O9 and a molecular weight of 553.57 g/mol. Its IUPAC name is [2-[6-(1-hydroxy-2-oxoethyl)-7-(methoxymethyl)-8-oxo-16,18-dioxa-2,9-diazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1(20),2,4,6,11,13,15(19)-heptaen-12-yl]ethyl-propan-2-ylamino]oxymethyl acetate.
| Compound Name | [2-[6-(1-hydroxy-2-oxoethyl)-7-(methoxymethyl)-8-oxo-16,18-dioxa-2,9-diazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1(20),2,4,6,11,13,15(19)-heptaen-12-yl]ethyl-propan-2-ylamino]oxymethyl acetate |
|---|---|
| PubChem CID | 167175071 |
| Molecular Formula | C28H31N3O9 |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | [2-[6-(1-hydroxy-2-oxoethyl)-7-(methoxymethyl)-8-oxo-16,18-dioxa-2,9-diazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1(20),2,4,6,11,13,15(19)-heptaen-12-yl]ethyl-propan-2-ylamino]oxymethyl acetate |
| SMILES | COCc1c(C(O)C=O)cc2n(c1=O)Cc1c-2nc2cc3c(cc2c1CCN(OCOC(C)=O)C(C)C)OCO3 |
| InChI | InChI=1S/C28H31N3O9/c1-15(2)31(40-14-37-16(3)33)6-5-17-18-8-25-26(39-13-38-25)9-22(18)29-27-20(17)10-30-23(27)7-19(24(34)11-32)21(12-36-4)28(30)35/h7-9,11,15,24,34H,5-6,10,12-14H2,1-4H3 |
| InChIKey | MZHSJFZHTVIRHK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 138.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|