C21H22N2O5 — CID 145495911
ethane;2-hydroxy-2-[2-hydroxy-8-(methoxymethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl]acetaldehyde (PubChem CID 145495911) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is ethane;2-hydroxy-2-[2-hydroxy-8-(methoxymethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl]acetaldehyde.
| Compound Name | ethane;2-hydroxy-2-[2-hydroxy-8-(methoxymethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl]acetaldehyde |
|---|---|
| PubChem CID | 145495911 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | ethane;2-hydroxy-2-[2-hydroxy-8-(methoxymethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl]acetaldehyde |
| SMILES | CC.COCc1c(C(O)C=O)cc2n(c1=O)Cc1cc3cc(O)ccc3nc1-2 |
| InChI | InChI=1S/C19H16N2O5.C2H6/c1-26-9-14-13(17(24)8-22)6-16-18-11(7-21(16)19(14)25)4-10-5-12(23)2-3-15(10)20-18;1-2/h2-6,8,17,23-24H,7,9H2,1H3;1-2H3 |
| InChIKey | IOQKNPOZEUZOGZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|