C19H16N2O5 — CID 146416809
[2-hydroxy-7-[(1R)-1-hydroxyethyl]-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl formate (PubChem CID 146416809) has the molecular formula C19H16N2O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is [2-hydroxy-7-[(1R)-1-hydroxyethyl]-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl formate.
| Compound Name | [2-hydroxy-7-[(1R)-1-hydroxyethyl]-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl formate |
|---|---|
| PubChem CID | 146416809 |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | [2-hydroxy-7-[(1R)-1-hydroxyethyl]-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl formate |
| SMILES | C[C@@H](O)c1cc2n(c(=O)c1COC=O)Cc1cc3cc(O)ccc3nc1-2 |
| InChI | InChI=1S/C19H16N2O5/c1-10(23)14-6-17-18-12(4-11-5-13(24)2-3-16(11)20-18)7-21(17)19(25)15(14)8-26-9-22/h2-6,9-10,23-24H,7-8H2,1H3/t10-/m1/s1 |
| InChIKey | DCAGEUDXCLTPDM-SNVBAGLBSA-N |
| XLogP | 1.86 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|