C27H32FN3O5S — CID 171831186
ethane;[14-fluoro-7-(1-hydroxyethyl)-15-methyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-6-yl]methyl formate;2-sulfanylacetamide (PubChem CID 171831186) has the molecular formula C27H32FN3O5S and a molecular weight of 529.63 g/mol. Its IUPAC name is ethane;[14-fluoro-7-(1-hydroxyethyl)-15-methyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-6-yl]methyl formate;2-sulfanylacetamide.
| Compound Name | ethane;[14-fluoro-7-(1-hydroxyethyl)-15-methyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-6-yl]methyl formate;2-sulfanylacetamide |
|---|---|
| PubChem CID | 171831186 |
| Molecular Formula | C27H32FN3O5S |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | ethane;[14-fluoro-7-(1-hydroxyethyl)-15-methyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-6-yl]methyl formate;2-sulfanylacetamide |
| SMILES | CC.Cc1c(F)cc2nc3c(c4c2c1CCC4)Cn1c-3cc(C(C)O)c(COC=O)c1=O.NC(=O)CS |
| InChI | InChI=1S/C23H21FN2O4.C2H5NOS.C2H6/c1-11-13-4-3-5-14-16-8-26-20(22(16)25-19(21(13)14)7-18(11)24)6-15(12(2)28)17(23(26)29)9-30-10-27;3-2(4)1-5;1-2/h6-7,10,12,28H,3-5,8-9H2,1-2H3;5H,1H2,(H2,3,4);1-2H3 |
| InChIKey | QMACDPMCZFMGCV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|