C25H25FN2O4 — CID 170097504
[7-(1-ethoxyethyl)-14-fluoro-15-methyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-6-yl]methyl formate (PubChem CID 170097504) has the molecular formula C25H25FN2O4 and a molecular weight of 436.48 g/mol. Its IUPAC name is [7-(1-ethoxyethyl)-14-fluoro-15-methyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-6-yl]methyl formate.
| Compound Name | [7-(1-ethoxyethyl)-14-fluoro-15-methyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-6-yl]methyl formate |
|---|---|
| PubChem CID | 170097504 |
| Molecular Formula | C25H25FN2O4 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | [7-(1-ethoxyethyl)-14-fluoro-15-methyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-6-yl]methyl formate |
| SMILES | CCOC(C)c1cc2n(c(=O)c1COC=O)Cc1c-2nc2cc(F)c(C)c3c2c1CCC3 |
| InChI | InChI=1S/C25H25FN2O4/c1-4-32-14(3)17-8-22-24-18(10-28(22)25(30)19(17)11-31-12-29)16-7-5-6-15-13(2)20(26)9-21(27-24)23(15)16/h8-9,12,14H,4-7,10-11H2,1-3H3 |
| InChIKey | HDYLCRSJTQSCOQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|