C30H37FN2O3 — CID 169179066
ethane;(2S)-2-[14-fluoro-15-methyl-6-(2-methylbutyl)-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-7-yl]-2-hydroxybutanal (PubChem CID 169179066) has the molecular formula C30H37FN2O3 and a molecular weight of 492.64 g/mol. Its IUPAC name is ethane;(2S)-2-[14-fluoro-15-methyl-6-(2-methylbutyl)-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-7-yl]-2-hydroxybutanal.
| Compound Name | ethane;(2S)-2-[14-fluoro-15-methyl-6-(2-methylbutyl)-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-7-yl]-2-hydroxybutanal |
|---|---|
| PubChem CID | 169179066 |
| Molecular Formula | C30H37FN2O3 |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | ethane;(2S)-2-[14-fluoro-15-methyl-6-(2-methylbutyl)-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-7-yl]-2-hydroxybutanal |
| SMILES | CC.CCC(C)Cc1c([C@](O)(C=O)CC)cc2n(c1=O)Cc1c-2nc2cc(F)c(C)c3c2c1CCC3 |
| InChI | InChI=1S/C28H31FN2O3.C2H6/c1-5-15(3)10-19-21(28(34,6-2)14-32)11-24-26-20(13-31(24)27(19)33)18-9-7-8-17-16(4)22(29)12-23(30-26)25(17)18;1-2/h11-12,14-15,34H,5-10,13H2,1-4H3;1-2H3/t15?,28-;/m1./s1 |
| InChIKey | KFTIZCCTKFVGPH-DDXUXMEOSA-N |
| XLogP | 5.77 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|