C25H24FN3O3 — CID 170091068
14-fluoro-7,15-dimethyl-6-[(2-methyl-1-nitrosoprop-1-enoxy)methyl]-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-5-one (PubChem CID 170091068) has the molecular formula C25H24FN3O3 and a molecular weight of 433.48 g/mol. Its IUPAC name is 14-fluoro-7,15-dimethyl-6-[(2-methyl-1-nitrosoprop-1-enoxy)methyl]-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-5-one.
| Compound Name | 14-fluoro-7,15-dimethyl-6-[(2-methyl-1-nitrosoprop-1-enoxy)methyl]-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-5-one |
|---|---|
| PubChem CID | 170091068 |
| Molecular Formula | C25H24FN3O3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 14-fluoro-7,15-dimethyl-6-[(2-methyl-1-nitrosoprop-1-enoxy)methyl]-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-5-one |
| SMILES | CC(C)=C(N=O)OCc1c(C)cc2n(c1=O)Cc1c-2nc2cc(F)c(C)c3c2c1CCC3 |
| InChI | InChI=1S/C25H24FN3O3/c1-12(2)24(28-31)32-11-18-13(3)8-21-23-17(10-29(21)25(18)30)16-7-5-6-15-14(4)19(26)9-20(27-23)22(15)16/h8-9H,5-7,10-11H2,1-4H3 |
| InChIKey | DEWZPGUANWZQIA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|