C27H27FN2O3 — CID 170741465
6-ethyl-14-fluoro-7-[(3S)-3-hydroxy-2-methyl-4-oxopent-1-en-3-yl]-15-methyl-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-5-one (PubChem CID 170741465) has the molecular formula C27H27FN2O3 and a molecular weight of 446.52 g/mol. Its IUPAC name is 6-ethyl-14-fluoro-7-[(3S)-3-hydroxy-2-methyl-4-oxopent-1-en-3-yl]-15-methyl-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-5-one.
| Compound Name | 6-ethyl-14-fluoro-7-[(3S)-3-hydroxy-2-methyl-4-oxopent-1-en-3-yl]-15-methyl-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-5-one |
|---|---|
| PubChem CID | 170741465 |
| Molecular Formula | C27H27FN2O3 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 6-ethyl-14-fluoro-7-[(3S)-3-hydroxy-2-methyl-4-oxopent-1-en-3-yl]-15-methyl-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-5-one |
| SMILES | C=C(C)[C@@](O)(C(C)=O)c1cc2n(c(=O)c1CC)Cc1c-2nc2cc(F)c(C)c3c2c1CCC3 |
| InChI | InChI=1S/C27H27FN2O3/c1-6-16-20(27(33,13(2)3)15(5)31)10-23-25-19(12-30(23)26(16)32)18-9-7-8-17-14(4)21(28)11-22(29-25)24(17)18/h10-11,33H,2,6-9,12H2,1,3-5H3/t27-/m1/s1 |
| InChIKey | QMFDAIZZHIIKRF-HHHXNRCGSA-N |
| XLogP | 4.28 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|