C26H23FN2O3 — CID 170744764
(10S)-10-ethenyl-10-ethyl-18-fluoro-19-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione (PubChem CID 170744764) has the molecular formula C26H23FN2O3 and a molecular weight of 430.48 g/mol. Its IUPAC name is (10S)-10-ethenyl-10-ethyl-18-fluoro-19-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione.
| Compound Name | (10S)-10-ethenyl-10-ethyl-18-fluoro-19-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione |
|---|---|
| PubChem CID | 170744764 |
| Molecular Formula | C26H23FN2O3 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (10S)-10-ethenyl-10-ethyl-18-fluoro-19-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione |
| SMILES | C=C[C@]1(CC)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(C)c3c1c2CCC3 |
| InChI | InChI=1S/C26H23FN2O3/c1-4-26(5-2)18-9-21-23-16(11-29(21)24(30)17(18)12-32-25(26)31)15-8-6-7-14-13(3)19(27)10-20(28-23)22(14)15/h4,9-10H,1,5-8,11-12H2,2-3H3/t26-/m1/s1 |
| InChIKey | GACRTFPMAZWTLL-AREMUKBSSA-N |
| XLogP | 4.25 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|