C25H21FN2O4Si — CID 174260907
CID 174260907 (PubChem CID 174260907) has the molecular formula C25H21FN2O4Si and a molecular weight of 460.54 g/mol.
| Compound Name | CID 174260907 |
|---|---|
| PubChem CID | 174260907 |
| Molecular Formula | C25H21FN2O4Si |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | — |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(C)c3c1c2C1[Si]C1CC3 |
| InChI | InChI=1S/C25H21FN2O4Si/c1-3-25(31)14-6-17-21-12(8-28(17)23(29)13(14)9-32-24(25)30)20-19-11(4-5-18-22(20)33-18)10(2)15(26)7-16(19)27-21/h6-7,18,22,31H,3-5,8-9H2,1-2H3/t18?,22?,25-/m0/s1 |
| InChIKey | GBYGXWALTFSZRY-OSHJFMDRSA-N |
| XLogP | 3.02 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|