C27H26FN3O5 — CID 167413934
(10S,23S)-10-ethyl-18-fluoro-10-hydroxy-23-[2-(hydroxymethyl)aziridin-1-yl]-19-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione (PubChem CID 167413934) has the molecular formula C27H26FN3O5 and a molecular weight of 491.52 g/mol. Its IUPAC name is (10S,23S)-10-ethyl-18-fluoro-10-hydroxy-23-[2-(hydroxymethyl)aziridin-1-yl]-19-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione.
| Compound Name | (10S,23S)-10-ethyl-18-fluoro-10-hydroxy-23-[2-(hydroxymethyl)aziridin-1-yl]-19-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione |
|---|---|
| PubChem CID | 167413934 |
| Molecular Formula | C27H26FN3O5 |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | (10S,23S)-10-ethyl-18-fluoro-10-hydroxy-23-[2-(hydroxymethyl)aziridin-1-yl]-19-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(C)c3c1c2[C@@H](N1CC1CO)CC3 |
| InChI | InChI=1S/C27H26FN3O5/c1-3-27(35)17-6-21-24-15(9-31(21)25(33)16(17)11-36-26(27)34)23-20(30-8-13(30)10-32)5-4-14-12(2)18(28)7-19(29-24)22(14)23/h6-7,13,20,32,35H,3-5,8-11H2,1-2H3/t13?,20-,27-,30?/m0/s1 |
| InChIKey | PDPURGWJDSPDSW-FRPPRSIFSA-N |
| XLogP | 2.19 |
| TPSA | 104.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|