C23H21FN2O3 — CID 170076537
(14-fluoro-7,15-dimethyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-6-yl)methyl acetate (PubChem CID 170076537) has the molecular formula C23H21FN2O3 and a molecular weight of 392.43 g/mol. Its IUPAC name is (14-fluoro-7,15-dimethyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-6-yl)methyl acetate.
| Compound Name | (14-fluoro-7,15-dimethyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-6-yl)methyl acetate |
|---|---|
| PubChem CID | 170076537 |
| Molecular Formula | C23H21FN2O3 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (14-fluoro-7,15-dimethyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-6-yl)methyl acetate |
| SMILES | CC(=O)OCc1c(C)cc2n(c1=O)Cc1c-2nc2cc(F)c(C)c3c2c1CCC3 |
| InChI | InChI=1S/C23H21FN2O3/c1-11-7-20-22-16(9-26(20)23(28)17(11)10-29-13(3)27)15-6-4-5-14-12(2)18(24)8-19(25-22)21(14)15/h7-8H,4-6,9-10H2,1-3H3 |
| InChIKey | BQCDJQXWVDULOE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |