C32H38FN3O3 — CID 178136319
2-[14-fluoro-6-(methoxymethyl)-15-methyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-7-yl]butanal;1-(1-methylcyclobutyl)ethenamine (PubChem CID 178136319) has the molecular formula C32H38FN3O3 and a molecular weight of 531.67 g/mol. Its IUPAC name is 2-[14-fluoro-6-(methoxymethyl)-15-methyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-7-yl]butanal;1-(1-methylcyclobutyl)ethenamine.
| Compound Name | 2-[14-fluoro-6-(methoxymethyl)-15-methyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-7-yl]butanal;1-(1-methylcyclobutyl)ethenamine |
|---|---|
| PubChem CID | 178136319 |
| Molecular Formula | C32H38FN3O3 |
| Molecular Weight | 531.67 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | 2-[14-fluoro-6-(methoxymethyl)-15-methyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-7-yl]butanal;1-(1-methylcyclobutyl)ethenamine |
| SMILES | C=C(N)C1(C)CCC1.CCC(C=O)c1cc2n(c(=O)c1COC)Cc1c-2nc2cc(F)c(C)c3c2c1CCC3 |
| InChI | InChI=1S/C25H25FN2O3.C7H13N/c1-4-14(11-29)17-8-22-24-18(10-28(22)25(30)19(17)12-31-3)16-7-5-6-15-13(2)20(26)9-21(27-24)23(15)16;1-6(8)7(2)4-3-5-7/h8-9,11,14H,4-7,10,12H2,1-3H3;1,3-5,8H2,2H3 |
| InChIKey | VSNVNLCCCJJWEG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.67 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|