C33H32FN3O4 — CID 177137074
N-[14-fluoro-6-(methoxymethyl)-15-methyl-5-oxo-7-(1-oxobutan-2-yl)-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-19-yl]-2-phenylacetamide (PubChem CID 177137074) has the molecular formula C33H32FN3O4 and a molecular weight of 553.63 g/mol. Its IUPAC name is N-[14-fluoro-6-(methoxymethyl)-15-methyl-5-oxo-7-(1-oxobutan-2-yl)-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-19-yl]-2-phenylacetamide.
| Compound Name | N-[14-fluoro-6-(methoxymethyl)-15-methyl-5-oxo-7-(1-oxobutan-2-yl)-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-19-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 177137074 |
| Molecular Formula | C33H32FN3O4 |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | N-[14-fluoro-6-(methoxymethyl)-15-methyl-5-oxo-7-(1-oxobutan-2-yl)-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-19-yl]-2-phenylacetamide |
| SMILES | CCC(C=O)c1cc2n(c(=O)c1COC)Cc1c-2nc2cc(F)c(C)c3c2c1C(NC(=O)Cc1ccccc1)CC3 |
| InChI | InChI=1S/C33H32FN3O4/c1-4-20(16-38)22-13-28-32-23(15-37(28)33(40)24(22)17-41-3)31-26(35-29(39)12-19-8-6-5-7-9-19)11-10-21-18(2)25(34)14-27(36-32)30(21)31/h5-9,13-14,16,20,26H,4,10-12,15,17H2,1-3H3,(H,35,39) |
| InChIKey | CBWVEORWOCETBY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|