C25H26FN3O4 — CID 163276344
(2S)-2-[(19S)-19-amino-14-fluoro-6-(methoxymethyl)-15-methyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-7-yl]-2-hydroxybutanal (PubChem CID 163276344) has the molecular formula C25H26FN3O4 and a molecular weight of 451.50 g/mol. Its IUPAC name is (2S)-2-[(19S)-19-amino-14-fluoro-6-(methoxymethyl)-15-methyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-7-yl]-2-hydroxybutanal.
| Compound Name | (2S)-2-[(19S)-19-amino-14-fluoro-6-(methoxymethyl)-15-methyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-7-yl]-2-hydroxybutanal |
|---|---|
| PubChem CID | 163276344 |
| Molecular Formula | C25H26FN3O4 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (2S)-2-[(19S)-19-amino-14-fluoro-6-(methoxymethyl)-15-methyl-5-oxo-4,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,6,8,10,12,14,16(20)-heptaen-7-yl]-2-hydroxybutanal |
| SMILES | CC[C@@](O)(C=O)c1cc2n(c(=O)c1COC)Cc1c-2nc2cc(F)c(C)c3c2c1[C@@H](N)CC3 |
| InChI | InChI=1S/C25H26FN3O4/c1-4-25(32,11-30)16-7-20-23-14(9-29(20)24(31)15(16)10-33-3)21-18(27)6-5-13-12(2)17(26)8-19(28-23)22(13)21/h7-8,11,18,32H,4-6,9-10,27H2,1-3H3/t18-,25+/m0/s1 |
| InChIKey | PELDEELHWZMVMP-AVRWGWEMSA-N |
| XLogP | 2.76 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|