C27H31BFN3O3 — CID 177135260
CID 177135260 (PubChem CID 177135260) has the molecular formula C27H31BFN3O3 and a molecular weight of 475.37 g/mol.
| Compound Name | CID 177135260 |
|---|---|
| PubChem CID | 177135260 |
| Molecular Formula | C27H31BFN3O3 |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | — |
| SMILES | CC.[B]NC1CCc2c(C)c(F)cc3nc4c(c1c23)Cn1c-4cc(C(C)CC)c(COC=O)c1=O |
| InChI | InChI=1S/C25H25BFN3O3.C2H6/c1-4-12(2)15-7-21-24-16(9-30(21)25(32)17(15)10-33-11-31)23-19(29-26)6-5-14-13(3)18(27)8-20(28-24)22(14)23;1-2/h7-8,11-12,19,29H,4-6,9-10H2,1-3H3;1-2H3 |
| InChIKey | KHHSKBMXNGQLBN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|