C22H25FN4O4 — CID 171520892
[2-amino-12-(aminomethyl)-3-fluoro-7-(1-hydroxyethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl formate;ethane (PubChem CID 171520892) has the molecular formula C22H25FN4O4 and a molecular weight of 428.46 g/mol. Its IUPAC name is [2-amino-12-(aminomethyl)-3-fluoro-7-(1-hydroxyethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl formate;ethane.
| Compound Name | [2-amino-12-(aminomethyl)-3-fluoro-7-(1-hydroxyethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl formate;ethane |
|---|---|
| PubChem CID | 171520892 |
| Molecular Formula | C22H25FN4O4 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | [2-amino-12-(aminomethyl)-3-fluoro-7-(1-hydroxyethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl formate;ethane |
| SMILES | CC.CC(O)c1cc2n(c(=O)c1COC=O)Cc1c-2nc2cc(F)c(N)cc2c1CN |
| InChI | InChI=1S/C20H19FN4O4.C2H6/c1-9(27)10-3-18-19-13(6-25(18)20(28)14(10)7-29-8-26)12(5-22)11-2-16(23)15(21)4-17(11)24-19;1-2/h2-4,8-9,27H,5-7,22-23H2,1H3;1-2H3 |
| InChIKey | CRBGFWNXPHGWSZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|