C28H39FN4O5 — CID 171520939
2-amino-3-fluoro-12-[[5-hydroxypentyl(methyl)amino]methyl]-8-(methoxymethyl)-7-methyl-11H-indolizino[1,2-b]quinolin-9-one;ethane;formic acid (PubChem CID 171520939) has the molecular formula C28H39FN4O5 and a molecular weight of 530.64 g/mol. Its IUPAC name is 2-amino-3-fluoro-12-[[5-hydroxypentyl(methyl)amino]methyl]-8-(methoxymethyl)-7-methyl-11H-indolizino[1,2-b]quinolin-9-one;ethane;formic acid.
| Compound Name | 2-amino-3-fluoro-12-[[5-hydroxypentyl(methyl)amino]methyl]-8-(methoxymethyl)-7-methyl-11H-indolizino[1,2-b]quinolin-9-one;ethane;formic acid |
|---|---|
| PubChem CID | 171520939 |
| Molecular Formula | C28H39FN4O5 |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 2-amino-3-fluoro-12-[[5-hydroxypentyl(methyl)amino]methyl]-8-(methoxymethyl)-7-methyl-11H-indolizino[1,2-b]quinolin-9-one;ethane;formic acid |
| SMILES | CC.COCc1c(C)cc2n(c1=O)Cc1c-2nc2cc(F)c(N)cc2c1CN(C)CCCCCO.O=CO |
| InChI | InChI=1S/C25H31FN4O3.C2H6.CH2O2/c1-15-9-23-24-18(13-30(23)25(32)19(15)14-33-3)17(12-29(2)7-5-4-6-8-31)16-10-21(27)20(26)11-22(16)28-24;1-2;2-1-3/h9-11,31H,4-8,12-14,27H2,1-3H3;1-2H3;1H,(H,2,3) |
| InChIKey | GPYOQAZEBGMNSJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 130.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|