C27H25FN4O4S — CID 171520914
[12-[[(4-aminophenyl)methylsulfanylamino]methyl]-3-fluoro-2,7-dimethyl-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl hydrogen carbonate (PubChem CID 171520914) has the molecular formula C27H25FN4O4S and a molecular weight of 520.59 g/mol. Its IUPAC name is [12-[[(4-aminophenyl)methylsulfanylamino]methyl]-3-fluoro-2,7-dimethyl-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl hydrogen carbonate.
| Compound Name | [12-[[(4-aminophenyl)methylsulfanylamino]methyl]-3-fluoro-2,7-dimethyl-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl hydrogen carbonate |
|---|---|
| PubChem CID | 171520914 |
| Molecular Formula | C27H25FN4O4S |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | [12-[[(4-aminophenyl)methylsulfanylamino]methyl]-3-fluoro-2,7-dimethyl-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl hydrogen carbonate |
| SMILES | Cc1cc2c(CNSCc3ccc(N)cc3)c3c(nc2cc1F)-c1cc(C)c(COC(=O)O)c(=O)n1C3 |
| InChI | InChI=1S/C27H25FN4O4S/c1-14-8-24-25-20(11-32(24)26(33)21(14)12-36-27(34)35)19(18-7-15(2)22(28)9-23(18)31-25)10-30-37-13-16-3-5-17(29)6-4-16/h3-9,30H,10-13,29H2,1-2H3,(H,34,35) |
| InChIKey | YXZNUBIZPXDGPH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|