C26H30FN7O6 — CID 172620133
[12-[[amino-[(Z)-2-amino-3-[[(2-aminoacetyl)amino]methoxy]but-1-enyl]amino]methyl]-3-fluoro-7-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl hydrogen carbonate (PubChem CID 172620133) has the molecular formula C26H30FN7O6 and a molecular weight of 555.57 g/mol. Its IUPAC name is [12-[[amino-[(Z)-2-amino-3-[[(2-aminoacetyl)amino]methoxy]but-1-enyl]amino]methyl]-3-fluoro-7-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl hydrogen carbonate.
| Compound Name | [12-[[amino-[(Z)-2-amino-3-[[(2-aminoacetyl)amino]methoxy]but-1-enyl]amino]methyl]-3-fluoro-7-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl hydrogen carbonate |
|---|---|
| PubChem CID | 172620133 |
| Molecular Formula | C26H30FN7O6 |
| Molecular Weight | 555.57 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | [12-[[amino-[(Z)-2-amino-3-[[(2-aminoacetyl)amino]methoxy]but-1-enyl]amino]methyl]-3-fluoro-7-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl hydrogen carbonate |
| SMILES | Cc1cc2n(c(=O)c1COC(=O)O)Cc1c-2nc2cc(F)ccc2c1CN(N)/C=C(\N)C(C)OCNC(=O)CN |
| InChI | InChI=1S/C26H30FN7O6/c1-13-5-22-24-18(9-34(22)25(36)19(13)11-39-26(37)38)17(16-4-3-15(27)6-21(16)32-24)8-33(30)10-20(29)14(2)40-12-31-23(35)7-28/h3-6,10,14H,7-9,11-12,28-30H2,1-2H3,(H,31,35)(H,37,38)/b20-10- |
| InChIKey | QALZDAMDAVJHGW-JMIUGGIZSA-N |
| XLogP | 0.98 |
| TPSA | 201.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.57 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|