C22H22FN3O4S — CID 171520937
2-[3-fluoro-8-(methoxymethyl)-12-[(methylsulfanylamino)methyl]-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl]-2-methoxyacetaldehyde (PubChem CID 171520937) has the molecular formula C22H22FN3O4S and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-[3-fluoro-8-(methoxymethyl)-12-[(methylsulfanylamino)methyl]-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl]-2-methoxyacetaldehyde.
| Compound Name | 2-[3-fluoro-8-(methoxymethyl)-12-[(methylsulfanylamino)methyl]-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl]-2-methoxyacetaldehyde |
|---|---|
| PubChem CID | 171520937 |
| Molecular Formula | C22H22FN3O4S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-[3-fluoro-8-(methoxymethyl)-12-[(methylsulfanylamino)methyl]-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl]-2-methoxyacetaldehyde |
| SMILES | COCc1c(C(C=O)OC)cc2n(c1=O)Cc1c-2nc2cc(F)ccc2c1CNSC |
| InChI | InChI=1S/C22H22FN3O4S/c1-29-11-17-14(20(10-27)30-2)7-19-21-16(9-26(19)22(17)28)15(8-24-31-3)13-5-4-12(23)6-18(13)25-21/h4-7,10,20,24H,8-9,11H2,1-3H3 |
| InChIKey | BENYVNYYCJNMFR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|