C30H39N3O4 — CID 163276439
2-[2-(5-amino-4,4-dimethylpentoxy)-12-ethyl-8-(methoxymethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl]butanal (PubChem CID 163276439) has the molecular formula C30H39N3O4 and a molecular weight of 505.66 g/mol. Its IUPAC name is 2-[2-(5-amino-4,4-dimethylpentoxy)-12-ethyl-8-(methoxymethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl]butanal.
| Compound Name | 2-[2-(5-amino-4,4-dimethylpentoxy)-12-ethyl-8-(methoxymethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl]butanal |
|---|---|
| PubChem CID | 163276439 |
| Molecular Formula | C30H39N3O4 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | 2-[2-(5-amino-4,4-dimethylpentoxy)-12-ethyl-8-(methoxymethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl]butanal |
| SMILES | CCc1c2c(nc3ccc(OCCCC(C)(C)CN)cc13)-c1cc(C(C=O)CC)c(COC)c(=O)n1C2 |
| InChI | InChI=1S/C30H39N3O4/c1-6-19(16-34)22-14-27-28-24(15-33(27)29(35)25(22)17-36-5)21(7-2)23-13-20(9-10-26(23)32-28)37-12-8-11-30(3,4)18-31/h9-10,13-14,16,19H,6-8,11-12,15,17-18,31H2,1-5H3 |
| InChIKey | GOIDJIRXHNSKBH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|