C36H42N4O6 — CID 163276435
N-[[12-ethyl-8-(methoxymethyl)-7-(2-methyl-1-oxobutan-2-yl)-9-oxo-11H-indolizino[1,2-b]quinolin-2-yl]oxymethyl]formamide;4-(2-methylpropanimidoyl)phenol (PubChem CID 163276435) has the molecular formula C36H42N4O6 and a molecular weight of 626.75 g/mol. Its IUPAC name is N-[[12-ethyl-8-(methoxymethyl)-7-(2-methyl-1-oxobutan-2-yl)-9-oxo-11H-indolizino[1,2-b]quinolin-2-yl]oxymethyl]formamide;4-(2-methylpropanimidoyl)phenol.
| Compound Name | N-[[12-ethyl-8-(methoxymethyl)-7-(2-methyl-1-oxobutan-2-yl)-9-oxo-11H-indolizino[1,2-b]quinolin-2-yl]oxymethyl]formamide;4-(2-methylpropanimidoyl)phenol |
|---|---|
| PubChem CID | 163276435 |
| Molecular Formula | C36H42N4O6 |
| Molecular Weight | 626.75 g/mol |
| Exact Mass | 626.31 |
| IUPAC Name | N-[[12-ethyl-8-(methoxymethyl)-7-(2-methyl-1-oxobutan-2-yl)-9-oxo-11H-indolizino[1,2-b]quinolin-2-yl]oxymethyl]formamide;4-(2-methylpropanimidoyl)phenol |
| SMILES | CCc1c2c(nc3ccc(OCNC=O)cc13)-c1cc(C(C)(C=O)CC)c(COC)c(=O)n1C2.[H]/N=C(/c1ccc(O)cc1)C(C)C |
| InChI | InChI=1S/C26H29N3O5.C10H13NO/c1-5-17-18-9-16(34-15-27-14-31)7-8-22(18)28-24-19(17)11-29-23(24)10-21(26(3,6-2)13-30)20(12-33-4)25(29)32;1-7(2)10(11)8-3-5-9(12)6-4-8/h7-10,13-14H,5-6,11-12,15H2,1-4H3,(H,27,31);3-7,11-12H,1-2H3/b;11-10+ |
| InChIKey | KOGHIRBUJCILJQ-AZQMUMGESA-N |
| XLogP | 5.50 |
| TPSA | 143.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.75 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|