C21H20N2O5 — CID 153350098
[12-ethyl-2-hydroxy-7-(1-hydroxyethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl formate (PubChem CID 153350098) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is [12-ethyl-2-hydroxy-7-(1-hydroxyethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl formate.
| Compound Name | [12-ethyl-2-hydroxy-7-(1-hydroxyethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl formate |
|---|---|
| PubChem CID | 153350098 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [12-ethyl-2-hydroxy-7-(1-hydroxyethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-8-yl]methyl formate |
| SMILES | CCc1c2c(nc3ccc(O)cc13)-c1cc(C(C)O)c(COC=O)c(=O)n1C2 |
| InChI | InChI=1S/C21H20N2O5/c1-3-13-15-6-12(26)4-5-18(15)22-20-16(13)8-23-19(20)7-14(11(2)25)17(21(23)27)9-28-10-24/h4-7,10-11,25-26H,3,8-9H2,1-2H3 |
| InChIKey | WYFPUUOEIAJHLN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|