C21H22N2O3 — CID 178136482
2-[2,3-bis(ethenyl)-8-(methoxymethyl)-7-oxo-5H-pyrido[2,3-a]indolizin-9-yl]butanal (PubChem CID 178136482) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-[2,3-bis(ethenyl)-8-(methoxymethyl)-7-oxo-5H-pyrido[2,3-a]indolizin-9-yl]butanal.
| Compound Name | 2-[2,3-bis(ethenyl)-8-(methoxymethyl)-7-oxo-5H-pyrido[2,3-a]indolizin-9-yl]butanal |
|---|---|
| PubChem CID | 178136482 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2-[2,3-bis(ethenyl)-8-(methoxymethyl)-7-oxo-5H-pyrido[2,3-a]indolizin-9-yl]butanal |
| SMILES | C=Cc1cc2c(nc1C=C)-c1cc(C(C=O)CC)c(COC)c(=O)n1C2 |
| InChI | InChI=1S/C21H22N2O3/c1-5-13-8-15-10-23-19(20(15)22-18(13)7-3)9-16(14(6-2)11-24)17(12-26-4)21(23)25/h5,7-9,11,14H,1,3,6,10,12H2,2,4H3 |
| InChIKey | MZCVKXMMAXYNIZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|