C26H31N2O7P — CID 144515875
ethane;[1-[8-(methoxymethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl]-2-oxoethyl] oxolan-2-ylmethyl hydrogen phosphite (PubChem CID 144515875) has the molecular formula C26H31N2O7P and a molecular weight of 514.52 g/mol. Its IUPAC name is ethane;[1-[8-(methoxymethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl]-2-oxoethyl] oxolan-2-ylmethyl hydrogen phosphite.
| Compound Name | ethane;[1-[8-(methoxymethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl]-2-oxoethyl] oxolan-2-ylmethyl hydrogen phosphite |
|---|---|
| PubChem CID | 144515875 |
| Molecular Formula | C26H31N2O7P |
| Molecular Weight | 514.52 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | ethane;[1-[8-(methoxymethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl]-2-oxoethyl] oxolan-2-ylmethyl hydrogen phosphite |
| SMILES | CC.COCc1c(C(C=O)OP(O)OCC2CCCO2)cc2n(c1=O)Cc1cc3ccccc3nc1-2 |
| InChI | InChI=1S/C24H25N2O7P.C2H6/c1-30-14-19-18(22(12-27)33-34(29)32-13-17-6-4-8-31-17)10-21-23-16(11-26(21)24(19)28)9-15-5-2-3-7-20(15)25-23;1-2/h2-3,5,7,9-10,12,17,22,29H,4,6,8,11,13-14H2,1H3;1-2H3 |
| InChIKey | GLWSKINBIJLCRW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|