C25H27N2O7P — CID 144515879
(14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl) oxolan-2-ylmethyl hydrogen phosphite;ethane (PubChem CID 144515879) has the molecular formula C25H27N2O7P and a molecular weight of 498.47 g/mol. Its IUPAC name is (14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl) oxolan-2-ylmethyl hydrogen phosphite;ethane.
| Compound Name | (14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl) oxolan-2-ylmethyl hydrogen phosphite;ethane |
|---|---|
| PubChem CID | 144515879 |
| Molecular Formula | C25H27N2O7P |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | (14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl) oxolan-2-ylmethyl hydrogen phosphite;ethane |
| SMILES | CC.O=C1OCc2c(cc3n(c2=O)Cc2cc4ccccc4nc2-3)C1OP(O)OCC1CCCO1 |
| InChI | InChI=1S/C23H21N2O7P.C2H6/c26-22-17-12-30-23(27)21(32-33(28)31-11-15-5-3-7-29-15)16(17)9-19-20-14(10-25(19)22)8-13-4-1-2-6-18(13)24-20;1-2/h1-2,4,6,8-9,15,21,28H,3,5,7,10-12H2;1-2H3 |
| InChIKey | XFTSVLZSVUDHMW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|