C20H17N2O5P — CID 176554330
ethyl-(7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-yl)phosphinous acid (PubChem CID 176554330) has the molecular formula C20H17N2O5P and a molecular weight of 396.34 g/mol. Its IUPAC name is ethyl-(7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-yl)phosphinous acid.
| Compound Name | ethyl-(7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-yl)phosphinous acid |
|---|---|
| PubChem CID | 176554330 |
| Molecular Formula | C20H17N2O5P |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | ethyl-(7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-yl)phosphinous acid |
| SMILES | CCP(O)C1C(=O)OCc2c1cc1n(c2=O)Cc2cc3cc(O)ccc3nc2-1 |
| InChI | InChI=1S/C20H17N2O5P/c1-2-28(26)18-13-7-16-17-11(5-10-6-12(23)3-4-15(10)21-17)8-22(16)19(24)14(13)9-27-20(18)25/h3-7,18,23,26H,2,8-9H2,1H3 |
| InChIKey | MONPECRZECHEBN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|